C32H58O4SSi — CID 134830707
[(7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-4-en-8-yl] 4-methylbenzenesulfonate (PubChem CID 134830707) has the molecular formula C32H58O4SSi and a molecular weight of 566.97 g/mol. Its IUPAC name is [(7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-4-en-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [(7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-4-en-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134830707 |
| Molecular Formula | C32H58O4SSi |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | [(7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-4-en-8-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCCCCCCC[C@@H](OS(=O)(=O)c1ccc(C)cc1)[C@H](CC=CCC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H58O4SSi/c1-10-11-12-13-14-15-16-17-21-30(35-37(33,34)29-25-23-28(4)24-26-29)31(22-19-18-20-27(2)3)36-38(8,9)32(5,6)7/h18-19,23-27,30-31H,10-17,20-22H2,1-9H3/t30-,31+/m1/s1 |
| InChIKey | BIHIDTMFMMIRMG-JSOSNVBQSA-N |
| XLogP | 9.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|