C29H44O4SSi — CID 134835502
[(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methyl-5-(4-methylphenyl)sulfonylnon-6-en-2-ynyl]-trimethylsilane (PubChem CID 134835502) has the molecular formula C29H44O4SSi and a molecular weight of 516.82 g/mol. Its IUPAC name is [(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methyl-5-(4-methylphenyl)sulfonylnon-6-en-2-ynyl]-trimethylsilane.
| Compound Name | [(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methyl-5-(4-methylphenyl)sulfonylnon-6-en-2-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 134835502 |
| Molecular Formula | C29H44O4SSi |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methyl-5-(4-methylphenyl)sulfonylnon-6-en-2-ynyl]-trimethylsilane |
| SMILES | C/C(=C\C(CC#CC[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1)CC[C@H]1O[C@]1(C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C29H44O4SSi/c1-22-12-15-24(16-13-22)34(30,31)25(11-9-10-20-35(6,7)8)21-23(2)14-17-27-29(5,33-27)19-18-26-28(3,4)32-26/h12-13,15-16,21,25-27H,11,14,17-20H2,1-8H3/b23-21+/t25?,26-,27-,29-/m1/s1 |
| InChIKey | YGEWXIACHFKCMA-IKWCEPTFSA-N |
| XLogP | 6.71 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|