C28H50O6SSi2 — CID 122207091
[(4S,5R)-2,2-ditert-butyl-4-[[3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]-1,3,2-dioxasilinan-5-yl]oxy-diethyl-propan-2-ylsilane (PubChem CID 122207091) has the molecular formula C28H50O6SSi2 and a molecular weight of 570.94 g/mol. Its IUPAC name is [(4S,5R)-2,2-ditert-butyl-4-[[3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]-1,3,2-dioxasilinan-5-yl]oxy-diethyl-propan-2-ylsilane.
| Compound Name | [(4S,5R)-2,2-ditert-butyl-4-[[3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]-1,3,2-dioxasilinan-5-yl]oxy-diethyl-propan-2-ylsilane |
|---|---|
| PubChem CID | 122207091 |
| Molecular Formula | C28H50O6SSi2 |
| Molecular Weight | 570.94 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | [(4S,5R)-2,2-ditert-butyl-4-[[3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]-1,3,2-dioxasilinan-5-yl]oxy-diethyl-propan-2-ylsilane |
| SMILES | CC[Si](CC)(O[C@@H]1CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]1CC1OC1S(=O)(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C28H50O6SSi2/c1-12-36(13-2,20(3)4)33-25-19-31-37(27(6,7)8,28(9,10)11)34-23(25)18-24-26(32-24)35(29,30)22-16-14-21(5)15-17-22/h14-17,20,23-26H,12-13,18-19H2,1-11H3/t23-,24?,25+,26?/m0/s1 |
| InChIKey | HDMCEFKXQSWNKA-GMIDLEKQSA-N |
| XLogP | 7.12 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.94 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|