C20H32O4SSi — CID 101200593
[(1R,2R,3R,4S,7R)-2-(benzenesulfonyl)-3-methyl-8-oxabicyclo[5.1.0]octan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101200593) has the molecular formula C20H32O4SSi and a molecular weight of 396.63 g/mol. Its IUPAC name is [(1R,2R,3R,4S,7R)-2-(benzenesulfonyl)-3-methyl-8-oxabicyclo[5.1.0]octan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R,3R,4S,7R)-2-(benzenesulfonyl)-3-methyl-8-oxabicyclo[5.1.0]octan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101200593 |
| Molecular Formula | C20H32O4SSi |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [(1R,2R,3R,4S,7R)-2-(benzenesulfonyl)-3-methyl-8-oxabicyclo[5.1.0]octan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H]1[C@@H](S(=O)(=O)c2ccccc2)[C@@H]2O[C@@H]2CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O4SSi/c1-14-16(24-26(5,6)20(2,3)4)12-13-17-18(23-17)19(14)25(21,22)15-10-8-7-9-11-15/h7-11,14,16-19H,12-13H2,1-6H3/t14-,16+,17-,18-,19-/m1/s1 |
| InChIKey | RJGUXSTZKXLCNT-RSRPTUBKSA-N |
| XLogP | 4.42 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|