C21H32O4SSi — CID 12061295
[(1S,2S,3R,4S,7S)-6-(benzenesulfonyl)-2,4-dimethyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 12061295) has the molecular formula C21H32O4SSi and a molecular weight of 408.64 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7S)-6-(benzenesulfonyl)-2,4-dimethyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,3R,4S,7S)-6-(benzenesulfonyl)-2,4-dimethyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 12061295 |
| Molecular Formula | C21H32O4SSi |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(1S,2S,3R,4S,7S)-6-(benzenesulfonyl)-2,4-dimethyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H]1[C@@H]2O[C@@H]2C(S(=O)(=O)c2ccccc2)=C[C@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O4SSi/c1-14-13-17(26(22,23)16-11-9-8-10-12-16)20-19(24-20)15(2)18(14)25-27(6,7)21(3,4)5/h8-15,18-20H,1-7H3/t14-,15+,18+,19-,20+/m0/s1 |
| InChIKey | AITLARXVPVNIJX-WTNXQADQSA-N |
| XLogP | 4.79 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|