C23H38O4SSi — CID 123148908
[(1R,3R)-3-(benzenesulfonyl)-5-(2-prop-2-enoxyethyl)cyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 123148908) has the molecular formula C23H38O4SSi and a molecular weight of 438.71 g/mol. Its IUPAC name is [(1R,3R)-3-(benzenesulfonyl)-5-(2-prop-2-enoxyethyl)cyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3R)-3-(benzenesulfonyl)-5-(2-prop-2-enoxyethyl)cyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 123148908 |
| Molecular Formula | C23H38O4SSi |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [(1R,3R)-3-(benzenesulfonyl)-5-(2-prop-2-enoxyethyl)cyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCOCCC1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C23H38O4SSi/c1-7-14-26-15-13-19-16-20(27-29(5,6)23(2,3)4)18-22(17-19)28(24,25)21-11-9-8-10-12-21/h7-12,19-20,22H,1,13-18H2,2-6H3/t19?,20-,22-/m1/s1 |
| InChIKey | QYOGSSGBPLUQAD-NQUCAWMESA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|