C25H40O3SSi — CID 16723992
[(1S,6S,8aS)-6-[2-(benzenesulfinyl)ethoxy]-8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 16723992) has the molecular formula C25H40O3SSi and a molecular weight of 448.75 g/mol. Its IUPAC name is [(1S,6S,8aS)-6-[2-(benzenesulfinyl)ethoxy]-8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,6S,8aS)-6-[2-(benzenesulfinyl)ethoxy]-8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 16723992 |
| Molecular Formula | C25H40O3SSi |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [(1S,6S,8aS)-6-[2-(benzenesulfinyl)ethoxy]-8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCC2=C[C@@H](OCCS(=O)c3ccccc3)CC[C@@]21C |
| InChI | InChI=1S/C25H40O3SSi/c1-24(2,3)30(5,6)28-23-14-10-11-20-19-21(15-16-25(20,23)4)27-17-18-29(26)22-12-8-7-9-13-22/h7-9,12-13,19,21,23H,10-11,14-18H2,1-6H3/t21-,23-,25-,29?/m0/s1 |
| InChIKey | AWYLVZUUEAHLBQ-GUGDZWNMSA-N |
| XLogP | 6.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|