C28H40O2SSi — CID 11059721
tert-butyl-dimethyl-[[(1R,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]methoxy]silane (PubChem CID 11059721) has the molecular formula C28H40O2SSi and a molecular weight of 468.78 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 11059721 |
| Molecular Formula | C28H40O2SSi |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C)C=C(CSc2ccccc2)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H40O2SSi/c1-27(2,3)32(5,6)30-22-28(4)19-24(21-31-25-15-11-8-12-16-25)17-18-26(28)29-20-23-13-9-7-10-14-23/h7-16,19,26H,17-18,20-22H2,1-6H3/t26-,28+/m0/s1 |
| InChIKey | VMGKCOPMLOZEES-XTEPFMGCSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|