C28H32F2O2SSi — CID 10767652
tert-butyl-[[(2R,3S)-4,4-difluoro-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane (PubChem CID 10767652) has the molecular formula C28H32F2O2SSi and a molecular weight of 498.71 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S)-4,4-difluoro-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3S)-4,4-difluoro-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10767652 |
| Molecular Formula | C28H32F2O2SSi |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | tert-butyl-[[(2R,3S)-4,4-difluoro-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1SCC(F)(F)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32F2O2SSi/c1-27(2,3)34(23-15-9-5-10-16-23,24-17-11-6-12-18-24)32-20-25-26(28(29,30)21-33-25)31-19-22-13-7-4-8-14-22/h4-18,25-26H,19-21H2,1-3H3/t25-,26-/m1/s1 |
| InChIKey | UUEZOLFXABVAKS-CLJLJLNGSA-N |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|