C28H34O3SSi — CID 10528669
(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-ol (PubChem CID 10528669) has the molecular formula C28H34O3SSi and a molecular weight of 478.73 g/mol. Its IUPAC name is (3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-ol.
| Compound Name | (3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-ol |
|---|---|
| PubChem CID | 10528669 |
| Molecular Formula | C28H34O3SSi |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1SC[C@@H](O)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O3SSi/c1-28(2,3)33(23-15-9-5-10-16-23,24-17-11-6-12-18-24)31-20-26-27(25(29)21-32-26)30-19-22-13-7-4-8-14-22/h4-18,25-27,29H,19-21H2,1-3H3/t25-,26-,27+/m1/s1 |
| InChIKey | UROOASPFQXQQKZ-PFBJBMPXSA-N |
| XLogP | 4.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|