C31H40O4Si — CID 10553560
(E,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-8-phenylmethoxyoct-2-ene-1,6-diol (PubChem CID 10553560) has the molecular formula C31H40O4Si and a molecular weight of 504.74 g/mol. Its IUPAC name is (E,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-8-phenylmethoxyoct-2-ene-1,6-diol.
| Compound Name | (E,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-8-phenylmethoxyoct-2-ene-1,6-diol |
|---|---|
| PubChem CID | 10553560 |
| Molecular Formula | C31H40O4Si |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (E,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-8-phenylmethoxyoct-2-ene-1,6-diol |
| SMILES | CC(C)(C)[Si](O[C@H](C/C=C/CO)[C@H](O)CCOCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40O4Si/c1-31(2,3)36(27-17-9-5-10-18-27,28-19-11-6-12-20-28)35-30(21-13-14-23-32)29(33)22-24-34-25-26-15-7-4-8-16-26/h4-20,29-30,32-33H,21-25H2,1-3H3/b14-13+/t29-,30-/m1/s1 |
| InChIKey | BZONOPADFCKPSQ-QAZGCBNDSA-N |
| XLogP | 4.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|