C45H78O5SSi2 — CID 23727958
[(E,2R,10R,14R)-4-(benzenesulfonyl)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-tert-butyl-dimethylsilane (PubChem CID 23727958) has the molecular formula C45H78O5SSi2 and a molecular weight of 787.35 g/mol. Its IUPAC name is [(E,2R,10R,14R)-4-(benzenesulfonyl)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,2R,10R,14R)-4-(benzenesulfonyl)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23727958 |
| Molecular Formula | C45H78O5SSi2 |
| Molecular Weight | 787.35 g/mol |
| Exact Mass | 786.51 |
| IUPAC Name | [(E,2R,10R,14R)-4-(benzenesulfonyl)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C(=C\CC[C@@H](C)CCC(OCc1ccccc1)[C@H](C)CCO[Si](C)(C)C(C)(C)C)CC(C[C@@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C45H78O5SSi2/c1-36(28-29-43(48-35-40-24-17-15-18-25-40)39(4)30-31-49-52(11,12)44(5,6)7)22-21-23-37(2)32-42(51(46,47)41-26-19-16-20-27-41)33-38(3)34-50-53(13,14)45(8,9)10/h15-20,23-27,36,38-39,42-43H,21-22,28-35H2,1-14H3/b37-23+/t36-,38-,39-,42?,43?/m1/s1 |
| InChIKey | RCYJFABUNWNZFC-SVWMLZAVSA-N |
| XLogP | 13.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.35 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|