C19H24O4SSi — CID 14385187
[(2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxiran-2-yl]-trimethylsilane (PubChem CID 14385187) has the molecular formula C19H24O4SSi and a molecular weight of 376.55 g/mol. Its IUPAC name is [(2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxiran-2-yl]-trimethylsilane.
| Compound Name | [(2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxiran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 14385187 |
| Molecular Formula | C19H24O4SSi |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxiran-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)[C@]1(S(=O)(=O)c2ccccc2)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C19H24O4SSi/c1-25(2,3)19(24(20,21)17-12-8-5-9-13-17)18(23-19)15-22-14-16-10-6-4-7-11-16/h4-13,18H,14-15H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | LGIAYNMMBHWTKW-MOPGFXCFSA-N |
| XLogP | 3.65 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|