C21H27FO4S — CID 102270642
4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxyoctan-3-ol (PubChem CID 102270642) has the molecular formula C21H27FO4S and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxyoctan-3-ol.
| Compound Name | 4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxyoctan-3-ol |
|---|---|
| PubChem CID | 102270642 |
| Molecular Formula | C21H27FO4S |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxyoctan-3-ol |
| SMILES | CCCCC(F)(C(O)CCOCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27FO4S/c1-2-3-15-21(22,27(24,25)19-12-8-5-9-13-19)20(23)14-16-26-17-18-10-6-4-7-11-18/h4-13,20,23H,2-3,14-17H2,1H3 |
| InChIKey | HRJAJUXSLWZMGG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|