C12H18O5S — CID 56665069
(1R,2S)-1,3-dimethoxy-1-(4-methylsulfonylphenyl)propan-2-ol (PubChem CID 56665069) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is (1R,2S)-1,3-dimethoxy-1-(4-methylsulfonylphenyl)propan-2-ol.
| Compound Name | (1R,2S)-1,3-dimethoxy-1-(4-methylsulfonylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 56665069 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (1R,2S)-1,3-dimethoxy-1-(4-methylsulfonylphenyl)propan-2-ol |
| SMILES | COC[C@H](O)[C@H](OC)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H18O5S/c1-16-8-11(13)12(17-2)9-4-6-10(7-5-9)18(3,14)15/h4-7,11-13H,8H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | IAJWLNCFEOAOGP-NWDGAFQWSA-N |
| XLogP | 0.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |