C11H16O5S — CID 56676499
(2S,3R)-3-methoxy-3-(4-methylsulfonylphenyl)propane-1,2-diol (PubChem CID 56676499) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is (2S,3R)-3-methoxy-3-(4-methylsulfonylphenyl)propane-1,2-diol.
| Compound Name | (2S,3R)-3-methoxy-3-(4-methylsulfonylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 56676499 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (2S,3R)-3-methoxy-3-(4-methylsulfonylphenyl)propane-1,2-diol |
| SMILES | CO[C@H](c1ccc(S(C)(=O)=O)cc1)[C@@H](O)CO |
| InChI | InChI=1S/C11H16O5S/c1-16-11(10(13)7-12)8-3-5-9(6-4-8)17(2,14)15/h3-6,10-13H,7H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | YVQLPXZFLTVEDH-WDEREUQCSA-N |
| XLogP | 0.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |