C25H35FO4S — CID 135062260
4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxydodecan-3-ol (PubChem CID 135062260) has the molecular formula C25H35FO4S and a molecular weight of 450.62 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxydodecan-3-ol.
| Compound Name | 4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxydodecan-3-ol |
|---|---|
| PubChem CID | 135062260 |
| Molecular Formula | C25H35FO4S |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 4-(benzenesulfonyl)-4-fluoro-1-phenylmethoxydodecan-3-ol |
| SMILES | CCCCCCCCC(F)(C(O)CCOCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H35FO4S/c1-2-3-4-5-6-13-19-25(26,31(28,29)23-16-11-8-12-17-23)24(27)18-20-30-21-22-14-9-7-10-15-22/h7-12,14-17,24,27H,2-6,13,18-21H2,1H3 |
| InChIKey | WWSQHJFZFRYEOO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|