C26H36F2O4S2Si — CID 139706493
[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanyl]-1-(4-methylsulfonylphenyl)propoxy]-triethylsilane (PubChem CID 139706493) has the molecular formula C26H36F2O4S2Si and a molecular weight of 542.79 g/mol. Its IUPAC name is [2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanyl]-1-(4-methylsulfonylphenyl)propoxy]-triethylsilane.
| Compound Name | [2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanyl]-1-(4-methylsulfonylphenyl)propoxy]-triethylsilane |
|---|---|
| PubChem CID | 139706493 |
| Molecular Formula | C26H36F2O4S2Si |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanyl]-1-(4-methylsulfonylphenyl)propoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(c1ccc(S(C)(=O)=O)cc1)C(C)SC(C)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C26H36F2O4S2Si/c1-7-35(8-2,9-3)32-25(20-10-13-22(14-11-20)34(6,29)30)18(4)33-19(5)26(17-31-26)23-15-12-21(27)16-24(23)28/h10-16,18-19,25H,7-9,17H2,1-6H3 |
| InChIKey | UZFYQYWOPCPMAL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|