C20H21F3O5S2 — CID 118432487
4-[3-(difluoromethyl)phenyl]sulfonyl-2-(2-fluoro-4-methylsulfonylphenyl)-4-methyloxane (PubChem CID 118432487) has the molecular formula C20H21F3O5S2 and a molecular weight of 462.51 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)phenyl]sulfonyl-2-(2-fluoro-4-methylsulfonylphenyl)-4-methyloxane.
| Compound Name | 4-[3-(difluoromethyl)phenyl]sulfonyl-2-(2-fluoro-4-methylsulfonylphenyl)-4-methyloxane |
|---|---|
| PubChem CID | 118432487 |
| Molecular Formula | C20H21F3O5S2 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 4-[3-(difluoromethyl)phenyl]sulfonyl-2-(2-fluoro-4-methylsulfonylphenyl)-4-methyloxane |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)F)c2)CCOC(c2ccc(S(C)(=O)=O)cc2F)C1 |
| InChI | InChI=1S/C20H21F3O5S2/c1-20(30(26,27)15-5-3-4-13(10-15)19(22)23)8-9-28-18(12-20)16-7-6-14(11-17(16)21)29(2,24)25/h3-7,10-11,18-19H,8-9,12H2,1-2H3 |
| InChIKey | GNDZVVQQLKVZDY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |