C26H21F3O5S2 — CID 134932225
1-methyl-4-[(E)-2-[1,1,1-trifluoro-4-(4-methylphenyl)sulfonyl-2-phenylbut-3-yn-2-yl]oxyethenyl]sulfonylbenzene (PubChem CID 134932225) has the molecular formula C26H21F3O5S2 and a molecular weight of 534.58 g/mol. Its IUPAC name is 1-methyl-4-[(E)-2-[1,1,1-trifluoro-4-(4-methylphenyl)sulfonyl-2-phenylbut-3-yn-2-yl]oxyethenyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(E)-2-[1,1,1-trifluoro-4-(4-methylphenyl)sulfonyl-2-phenylbut-3-yn-2-yl]oxyethenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 134932225 |
| Molecular Formula | C26H21F3O5S2 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 1-methyl-4-[(E)-2-[1,1,1-trifluoro-4-(4-methylphenyl)sulfonyl-2-phenylbut-3-yn-2-yl]oxyethenyl]sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C#CC(O/C=C/S(=O)(=O)c2ccc(C)cc2)(c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H21F3O5S2/c1-20-8-12-23(13-9-20)35(30,31)18-16-25(26(27,28)29,22-6-4-3-5-7-22)34-17-19-36(32,33)24-14-10-21(2)11-15-24/h3-15,17,19H,1-2H3/b19-17+ |
| InChIKey | QRNOZYVVQUQCRD-HTXNQAPBSA-N |
| XLogP | 5.46 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|