C24H19F3O4S2 — CID 162405614
[(2Z)-3-(4-methylphenyl)sulfinyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] trifluoromethanesulfonate (PubChem CID 162405614) has the molecular formula C24H19F3O4S2 and a molecular weight of 492.54 g/mol. Its IUPAC name is [(2Z)-3-(4-methylphenyl)sulfinyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] trifluoromethanesulfonate.
| Compound Name | [(2Z)-3-(4-methylphenyl)sulfinyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162405614 |
| Molecular Formula | C24H19F3O4S2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | [(2Z)-3-(4-methylphenyl)sulfinyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(=O)/C2=C(\OS(=O)(=O)C(F)(F)F)c3ccccc3CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H19F3O4S2/c1-16-10-14-19(15-11-16)32(28)23-21-9-5-3-7-18(21)13-12-17-6-2-4-8-20(17)22(23)31-33(29,30)24(25,26)27/h2-11,14-15H,12-13H2,1H3/b23-22- |
| InChIKey | YFYWQHZJYGAOEL-FCQUAONHSA-N |
| XLogP | 5.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|