C19H19F3O5S2 — CID 123799176
4-[3-(difluoromethyl)phenyl]sulfonyl-2-(3-fluoro-4-methylsulfonylphenyl)oxane (PubChem CID 123799176) has the molecular formula C19H19F3O5S2 and a molecular weight of 448.48 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)phenyl]sulfonyl-2-(3-fluoro-4-methylsulfonylphenyl)oxane.
| Compound Name | 4-[3-(difluoromethyl)phenyl]sulfonyl-2-(3-fluoro-4-methylsulfonylphenyl)oxane |
|---|---|
| PubChem CID | 123799176 |
| Molecular Formula | C19H19F3O5S2 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 4-[3-(difluoromethyl)phenyl]sulfonyl-2-(3-fluoro-4-methylsulfonylphenyl)oxane |
| SMILES | CS(=O)(=O)c1ccc(C2CC(S(=O)(=O)c3cccc(C(F)F)c3)CCO2)cc1F |
| InChI | InChI=1S/C19H19F3O5S2/c1-28(23,24)18-6-5-12(10-16(18)20)17-11-15(7-8-27-17)29(25,26)14-4-2-3-13(9-14)19(21)22/h2-6,9-10,15,17,19H,7-8,11H2,1H3 |
| InChIKey | CHIYSZMXNLXGHI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |