C21H16F2O3S — CID 58378831
2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]oxirane (PubChem CID 58378831) has the molecular formula C21H16F2O3S and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]oxirane.
| Compound Name | 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]oxirane |
|---|---|
| PubChem CID | 58378831 |
| Molecular Formula | C21H16F2O3S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]oxirane |
| SMILES | O=S(=O)(Cc1cccc(C2CO2)c1)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C21H16F2O3S/c22-17-6-9-19(20(23)11-17)15-4-7-18(8-5-15)27(24,25)13-14-2-1-3-16(10-14)21-12-26-21/h1-11,21H,12-13H2 |
| InChIKey | XWMRHRHXSGOLPL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|