C28H21F9O3S — CID 118212605
1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclopentyl]phenyl]propan-2-yl]oxymethyl]benzene (PubChem CID 118212605) has the molecular formula C28H21F9O3S and a molecular weight of 608.52 g/mol. Its IUPAC name is 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclopentyl]phenyl]propan-2-yl]oxymethyl]benzene.
| Compound Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclopentyl]phenyl]propan-2-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 118212605 |
| Molecular Formula | C28H21F9O3S |
| Molecular Weight | 608.52 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclopentyl]phenyl]propan-2-yl]oxymethyl]benzene |
| SMILES | C=C1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C28H21F9O3S/c1-17-13-14-25(15-17,41(38,39)21-11-9-20(29)10-12-21)18-5-7-19(8-6-18)26(27(32,33)34,28(35,36)37)40-16-22-23(30)3-2-4-24(22)31/h2-12H,1,13-16H2 |
| InChIKey | NAANTXMPGNCWAC-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.52 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|