C25H36O4SSi — CID 10504185
[(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate (PubChem CID 10504185) has the molecular formula C25H36O4SSi and a molecular weight of 460.71 g/mol. Its IUPAC name is [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate.
| Compound Name | [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate |
|---|---|
| PubChem CID | 10504185 |
| Molecular Formula | C25H36O4SSi |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate |
| SMILES | C#CC(=O)O[C@H]1C=C(CCS(=O)c2ccccc2)[C@](C)(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H36O4SSi/c1-8-23(26)29-21-14-16-25(5,19-28-31(6,7)24(2,3)4)20(18-21)15-17-30(27)22-12-10-9-11-13-22/h1,9-13,18,21H,14-17,19H2,2-7H3/t21-,25+,30?/m1/s1 |
| InChIKey | XNOBVXHLCKFCOQ-YQNOXLKYSA-N |
| XLogP | 5.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|