C25H40O5SSi — CID 101383103
[(1S)-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] 2-(4-methylphenyl)sulfonylacetate (PubChem CID 101383103) has the molecular formula C25H40O5SSi and a molecular weight of 480.74 g/mol. Its IUPAC name is [(1S)-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] 2-(4-methylphenyl)sulfonylacetate.
| Compound Name | [(1S)-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] 2-(4-methylphenyl)sulfonylacetate |
|---|---|
| PubChem CID | 101383103 |
| Molecular Formula | C25H40O5SSi |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [(1S)-2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] 2-(4-methylphenyl)sulfonylacetate |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)O[C@H]2CCCC=C2CO[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H40O5SSi/c1-18(2)32(19(3)4,20(5)6)29-16-22-10-8-9-11-24(22)30-25(26)17-31(27,28)23-14-12-21(7)13-15-23/h10,12-15,18-20,24H,8-9,11,16-17H2,1-7H3/t24-/m0/s1 |
| InChIKey | PMKRKJGNQQYEJW-DEOSSOPVSA-N |
| XLogP | 5.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|