C26H38O4SSi — CID 134918837
[(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] but-2-ynoate (PubChem CID 134918837) has the molecular formula C26H38O4SSi and a molecular weight of 474.74 g/mol. Its IUPAC name is [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] but-2-ynoate.
| Compound Name | [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] but-2-ynoate |
|---|---|
| PubChem CID | 134918837 |
| Molecular Formula | C26H38O4SSi |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-yl] but-2-ynoate |
| SMILES | CC#CC(=O)O[C@H]1C=C(CCS(=O)c2ccccc2)[C@](C)(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C26H38O4SSi/c1-8-12-24(27)30-22-15-17-26(5,20-29-32(6,7)25(2,3)4)21(19-22)16-18-31(28)23-13-10-9-11-14-23/h9-11,13-14,19,22H,15-18,20H2,1-7H3/t22-,26+,31?/m1/s1 |
| InChIKey | LHWBNRRBNUYRDF-WFOJBJJISA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|