C27H40O4SSi — CID 10863878
[(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate (PubChem CID 10863878) has the molecular formula C27H40O4SSi and a molecular weight of 488.77 g/mol. Its IUPAC name is [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate.
| Compound Name | [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate |
|---|---|
| PubChem CID | 10863878 |
| Molecular Formula | C27H40O4SSi |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylcyclohex-2-en-1-yl] prop-2-ynoate |
| SMILES | C#CC(=O)O[C@H]1C=C(CCS(=O)c2ccccc2)[C@](C)(CCCO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C27H40O4SSi/c1-8-25(28)31-23-15-18-27(5,17-12-19-30-33(6,7)26(2,3)4)22(21-23)16-20-32(29)24-13-10-9-11-14-24/h1,9-11,13-14,21,23H,12,15-20H2,2-7H3/t23-,27-,32?/m1/s1 |
| InChIKey | NVRPYQAQYOQAIL-YKXZUTBHSA-N |
| XLogP | 6.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|