C35H54O2SSi — CID 11146176
[(1R,6S)-6-[(1R)-2,2-dimethyl-1-phenylpropoxy]-1,3-dimethyl-4-phenylsulfanylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 11146176) has the molecular formula C35H54O2SSi and a molecular weight of 566.97 g/mol. Its IUPAC name is [(1R,6S)-6-[(1R)-2,2-dimethyl-1-phenylpropoxy]-1,3-dimethyl-4-phenylsulfanylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,6S)-6-[(1R)-2,2-dimethyl-1-phenylpropoxy]-1,3-dimethyl-4-phenylsulfanylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11146176 |
| Molecular Formula | C35H54O2SSi |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | [(1R,6S)-6-[(1R)-2,2-dimethyl-1-phenylpropoxy]-1,3-dimethyl-4-phenylsulfanylcyclohex-2-en-1-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC1=C[C@](C)(CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[C@@H](c2ccccc2)C(C)(C)C)CC1Sc1ccccc1 |
| InChI | InChI=1S/C35H54O2SSi/c1-25(2)39(26(3)4,27(5)6)36-24-35(11)23-28(7)31(38-30-20-16-13-17-21-30)22-32(35)37-33(34(8,9)10)29-18-14-12-15-19-29/h12-21,23,25-27,31-33H,22,24H2,1-11H3/t31?,32-,33-,35+/m0/s1 |
| InChIKey | PORBTQKQIFEWSU-FHMRKYRHSA-N |
| XLogP | 10.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|