C19H22OS — CID 85090288
(2R,3S)-3-(2-ethylphenyl)sulfanyl-2-phenyloxane (PubChem CID 85090288) has the molecular formula C19H22OS and a molecular weight of 298.45 g/mol. Its IUPAC name is (2R,3S)-3-(2-ethylphenyl)sulfanyl-2-phenyloxane.
| Compound Name | (2R,3S)-3-(2-ethylphenyl)sulfanyl-2-phenyloxane |
|---|---|
| PubChem CID | 85090288 |
| Molecular Formula | C19H22OS |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2R,3S)-3-(2-ethylphenyl)sulfanyl-2-phenyloxane |
| SMILES | CCc1ccccc1S[C@H]1CCCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22OS/c1-2-15-9-6-7-12-17(15)21-18-13-8-14-20-19(18)16-10-4-3-5-11-16/h3-7,9-12,18-19H,2,8,13-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | COEJGEQLNBROLN-RBUKOAKNSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |