C18H20OS — CID 85090300
(2R,3S)-3-(2-methylphenyl)sulfanyl-2-phenyloxane (PubChem CID 85090300) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is (2R,3S)-3-(2-methylphenyl)sulfanyl-2-phenyloxane.
| Compound Name | (2R,3S)-3-(2-methylphenyl)sulfanyl-2-phenyloxane |
|---|---|
| PubChem CID | 85090300 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2R,3S)-3-(2-methylphenyl)sulfanyl-2-phenyloxane |
| SMILES | Cc1ccccc1S[C@H]1CCCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20OS/c1-14-8-5-6-11-16(14)20-17-12-7-13-19-18(17)15-9-3-2-4-10-15/h2-6,8-11,17-18H,7,12-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | FKNJWJGSDDBORT-ZWKOTPCHSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |