C29H46O3SSi — CID 11214252
[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylmethoxyhexan-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11214252) has the molecular formula C29H46O3SSi and a molecular weight of 502.84 g/mol. Its IUPAC name is [(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylmethoxyhexan-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylmethoxyhexan-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11214252 |
| Molecular Formula | C29H46O3SSi |
| Molecular Weight | 502.84 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | [(2S)-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylmethoxyhexan-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | Cc1ccc([S@](=O)C[C@H](CCCCOCc2ccccc2)O[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C29H46O3SSi/c1-23(2)34(24(3)4,25(5)6)32-28(22-33(30)29-18-16-26(7)17-19-29)15-11-12-20-31-21-27-13-9-8-10-14-27/h8-10,13-14,16-19,23-25,28H,11-12,15,20-22H2,1-7H3/t28-,33+/m0/s1 |
| InChIKey | JMMARVURLIFPNZ-QPQHGXMVSA-N |
| XLogP | 8.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.84 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|