C24H32O3S — CID 11112154
1-methyl-4-[(E)-1-phenylmethoxydec-1-en-3-yl]sulfonylbenzene (PubChem CID 11112154) has the molecular formula C24H32O3S and a molecular weight of 400.58 g/mol. Its IUPAC name is 1-methyl-4-[(E)-1-phenylmethoxydec-1-en-3-yl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(E)-1-phenylmethoxydec-1-en-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 11112154 |
| Molecular Formula | C24H32O3S |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-methyl-4-[(E)-1-phenylmethoxydec-1-en-3-yl]sulfonylbenzene |
| SMILES | CCCCCCCC(/C=C/OCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H32O3S/c1-3-4-5-6-10-13-23(18-19-27-20-22-11-8-7-9-12-22)28(25,26)24-16-14-21(2)15-17-24/h7-9,11-12,14-19,23H,3-6,10,13,20H2,1-2H3/b19-18+ |
| InChIKey | HJFPUQCWNOPXKB-VHEBQXMUSA-N |
| XLogP | 6.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|