C27H40O2SSi — CID 11091730
[(1R,8E,8aS)-4,4,7,8a-tetramethyl-8-[[(S)-phenylsulfinyl]methylidene]-2,3-dihydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11091730) has the molecular formula C27H40O2SSi and a molecular weight of 456.77 g/mol. Its IUPAC name is [(1R,8E,8aS)-4,4,7,8a-tetramethyl-8-[[(S)-phenylsulfinyl]methylidene]-2,3-dihydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,8E,8aS)-4,4,7,8a-tetramethyl-8-[[(S)-phenylsulfinyl]methylidene]-2,3-dihydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11091730 |
| Molecular Formula | C27H40O2SSi |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(1R,8E,8aS)-4,4,7,8a-tetramethyl-8-[[(S)-phenylsulfinyl]methylidene]-2,3-dihydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=CC=C2C(C)(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)/C1=C/[S@](=O)c1ccccc1 |
| InChI | InChI=1S/C27H40O2SSi/c1-20-15-16-23-26(5,6)18-17-24(29-31(8,9)25(2,3)4)27(23,7)22(20)19-30(28)21-13-11-10-12-14-21/h10-16,19,24H,17-18H2,1-9H3/b22-19+/t24-,27-,30+/m1/s1 |
| InChIKey | RYUJYMIZFUZKRP-JAASCZNWSA-N |
| XLogP | 7.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|