C27H42O3SSi — CID 10790711
[(1S,4aS,8aS)-8-(benzenesulfonylmethyl)-4,4,7,8a-tetramethyl-1,2,3,4a-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10790711) has the molecular formula C27H42O3SSi and a molecular weight of 474.78 g/mol. Its IUPAC name is [(1S,4aS,8aS)-8-(benzenesulfonylmethyl)-4,4,7,8a-tetramethyl-1,2,3,4a-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,4aS,8aS)-8-(benzenesulfonylmethyl)-4,4,7,8a-tetramethyl-1,2,3,4a-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10790711 |
| Molecular Formula | C27H42O3SSi |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | [(1S,4aS,8aS)-8-(benzenesulfonylmethyl)-4,4,7,8a-tetramethyl-1,2,3,4a-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=C(CS(=O)(=O)c2ccccc2)[C@@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CCC(C)(C)[C@@H]2C=C1 |
| InChI | InChI=1S/C27H42O3SSi/c1-20-15-16-23-26(5,6)18-17-24(30-32(8,9)25(2,3)4)27(23,7)22(20)19-31(28,29)21-13-11-10-12-14-21/h10-16,23-24H,17-19H2,1-9H3/t23-,24-,27+/m0/s1 |
| InChIKey | QZLQPRBRYCESCA-NLJOTIRTSA-N |
| XLogP | 7.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|