C30H42O2S — CID 20666096
(3S,5R,10S,13R,17R)-17-[(2S)-1-(benzenesulfinyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 20666096) has the molecular formula C30H42O2S and a molecular weight of 466.73 g/mol. Its IUPAC name is (3S,5R,10S,13R,17R)-17-[(2S)-1-(benzenesulfinyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,10S,13R,17R)-17-[(2S)-1-(benzenesulfinyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 20666096 |
| Molecular Formula | C30H42O2S |
| Molecular Weight | 466.73 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (3S,5R,10S,13R,17R)-17-[(2S)-1-(benzenesulfinyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CS(=O)c1ccccc1)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C30H42O2S/c1-20(19-33(32)21-9-7-6-8-10-21)23-12-13-24-22-11-14-26-28(2,3)27(31)16-18-30(26,5)25(22)15-17-29(23,24)4/h6-10,13,20,23,26-27,31H,11-12,14-19H2,1-5H3/t20-,23-,26+,27+,29-,30-,33?/m1/s1 |
| InChIKey | LZYIZCVMHTXFJE-GOORCJAISA-N |
| XLogP | 7.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.73 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |