C22H36O3SSi — CID 11418377
[(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane (PubChem CID 11418377) has the molecular formula C22H36O3SSi and a molecular weight of 408.68 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11418377 |
| Molecular Formula | C22H36O3SSi |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C22H36O3SSi/c1-17(16-26(23,24)18-10-7-6-8-11-18)19-13-14-20-21(25-27(3,4)5)12-9-15-22(19,20)2/h6-8,10-11,17,19-21H,9,12-16H2,1-5H3/t17-,19-,20+,21+,22-/m1/s1 |
| InChIKey | NUCMRXOKMAWIAR-MBMVPVEPSA-N |
| XLogP | 5.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|