C23H38O3SSi — CID 10574264
[3-(benzenesulfonylmethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10574264) has the molecular formula C23H38O3SSi and a molecular weight of 422.71 g/mol. Its IUPAC name is [3-(benzenesulfonylmethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [3-(benzenesulfonylmethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10574264 |
| Molecular Formula | C23H38O3SSi |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [3-(benzenesulfonylmethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1=C(CS(=O)(=O)c2ccccc2)C(C)(C)C(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H38O3SSi/c1-18-14-15-19(16-26-28(7,8)22(2,3)4)23(5,6)21(18)17-27(24,25)20-12-10-9-11-13-20/h9-13,19H,14-17H2,1-8H3 |
| InChIKey | TYHPBVJGBZPCIF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|