C24H36O2SSi — CID 15731112
[(2E,4E)-1-(benzenesulfonyl)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-trimethylsilane (PubChem CID 15731112) has the molecular formula C24H36O2SSi and a molecular weight of 416.70 g/mol. Its IUPAC name is [(2E,4E)-1-(benzenesulfonyl)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-trimethylsilane.
| Compound Name | [(2E,4E)-1-(benzenesulfonyl)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 15731112 |
| Molecular Formula | C24H36O2SSi |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(2E,4E)-1-(benzenesulfonyl)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-trimethylsilane |
| SMILES | CC1=C(/C=C/C(C)=C/C([Si](C)(C)C)S(=O)(=O)c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H36O2SSi/c1-19(15-16-22-20(2)12-11-17-24(22,3)4)18-23(28(5,6)7)27(25,26)21-13-9-8-10-14-21/h8-10,13-16,18,23H,11-12,17H2,1-7H3/b16-15+,19-18+ |
| InChIKey | NAOBRXZMACGJGV-QQHFCDNLSA-N |
| XLogP | 6.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|