C21H34OSSi — CID 132942045
tert-butyl-dimethyl-[2-[(1R,6S)-3-methyl-6-phenylsulfanylcyclohex-3-en-1-yl]ethoxy]silane (PubChem CID 132942045) has the molecular formula C21H34OSSi and a molecular weight of 362.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[(1R,6S)-3-methyl-6-phenylsulfanylcyclohex-3-en-1-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[(1R,6S)-3-methyl-6-phenylsulfanylcyclohex-3-en-1-yl]ethoxy]silane |
|---|---|
| PubChem CID | 132942045 |
| Molecular Formula | C21H34OSSi |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | tert-butyl-dimethyl-[2-[(1R,6S)-3-methyl-6-phenylsulfanylcyclohex-3-en-1-yl]ethoxy]silane |
| SMILES | CC1=CC[C@H](Sc2ccccc2)[C@@H](CCO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H34OSSi/c1-17-12-13-20(23-19-10-8-7-9-11-19)18(16-17)14-15-22-24(5,6)21(2,3)4/h7-12,18,20H,13-16H2,1-6H3/t18-,20-/m0/s1 |
| InChIKey | HYVXYFQXNRCRJP-ICSRJNTNSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|