C16H26OSSi — CID 10946332
[(E)-2,4-dimethyl-5-phenylsulfanylpent-3-enoxy]-trimethylsilane (PubChem CID 10946332) has the molecular formula C16H26OSSi and a molecular weight of 294.54 g/mol. Its IUPAC name is [(E)-2,4-dimethyl-5-phenylsulfanylpent-3-enoxy]-trimethylsilane.
| Compound Name | [(E)-2,4-dimethyl-5-phenylsulfanylpent-3-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10946332 |
| Molecular Formula | C16H26OSSi |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(E)-2,4-dimethyl-5-phenylsulfanylpent-3-enoxy]-trimethylsilane |
| SMILES | C/C(=C\C(C)CO[Si](C)(C)C)CSc1ccccc1 |
| InChI | InChI=1S/C16H26OSSi/c1-14(12-17-19(3,4)5)11-15(2)13-18-16-9-7-6-8-10-16/h6-11,14H,12-13H2,1-5H3/b15-11+ |
| InChIKey | FOUKKAOIJBGUAI-RVDMUPIBSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|