C32H48O2SSi — CID 15406677
[(2E,4Z,6Z,8E)-4-(benzenesulfinyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-tert-butyl-dimethylsilane (PubChem CID 15406677) has the molecular formula C32H48O2SSi and a molecular weight of 524.89 g/mol. Its IUPAC name is [(2E,4Z,6Z,8E)-4-(benzenesulfinyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2E,4Z,6Z,8E)-4-(benzenesulfinyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15406677 |
| Molecular Formula | C32H48O2SSi |
| Molecular Weight | 524.89 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | [(2E,4Z,6Z,8E)-4-(benzenesulfinyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC1=C(/C=C/C(C)=C\C=C(C(\C)=C\CO[Si](C)(C)C(C)(C)C)/S(=O)c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H48O2SSi/c1-25(18-20-29-26(2)15-14-23-32(29,7)8)19-21-30(35(33)28-16-12-11-13-17-28)27(3)22-24-34-36(9,10)31(4,5)6/h11-13,16-22H,14-15,23-24H2,1-10H3/b20-18+,25-19-,27-22+,30-21- |
| InChIKey | OKMRUCVAFOKEGC-LYLCEUASSA-N |
| XLogP | 9.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.89 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|