C23H38OSSi — CID 10572512
tert-butyl-dimethyl-[[2,2,4-trimethyl-3-(phenylsulfanylmethyl)cyclohex-3-en-1-yl]methoxy]silane (PubChem CID 10572512) has the molecular formula C23H38OSSi and a molecular weight of 390.71 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[2,2,4-trimethyl-3-(phenylsulfanylmethyl)cyclohex-3-en-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[2,2,4-trimethyl-3-(phenylsulfanylmethyl)cyclohex-3-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 10572512 |
| Molecular Formula | C23H38OSSi |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | tert-butyl-dimethyl-[[2,2,4-trimethyl-3-(phenylsulfanylmethyl)cyclohex-3-en-1-yl]methoxy]silane |
| SMILES | CC1=C(CSc2ccccc2)C(C)(C)C(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H38OSSi/c1-18-14-15-19(16-24-26(7,8)22(2,3)4)23(5,6)21(18)17-25-20-12-10-9-11-13-20/h9-13,19H,14-17H2,1-8H3 |
| InChIKey | YTOOOENEYKFCFW-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|