C35H42OSSi — CID 134837527
2-[(1R,4aS,8aR)-8-methyl-1-phenylsulfanyl-2,5,6,8a-tetrahydro-1H-naphthalen-4a-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 134837527) has the molecular formula C35H42OSSi and a molecular weight of 538.87 g/mol. Its IUPAC name is 2-[(1R,4aS,8aR)-8-methyl-1-phenylsulfanyl-2,5,6,8a-tetrahydro-1H-naphthalen-4a-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(1R,4aS,8aR)-8-methyl-1-phenylsulfanyl-2,5,6,8a-tetrahydro-1H-naphthalen-4a-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134837527 |
| Molecular Formula | C35H42OSSi |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 2-[(1R,4aS,8aR)-8-methyl-1-phenylsulfanyl-2,5,6,8a-tetrahydro-1H-naphthalen-4a-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | CC1=CCC[C@]2(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=CC[C@@H](Sc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C35H42OSSi/c1-28-16-14-24-35(25-15-23-32(33(28)35)37-29-17-8-5-9-18-29)26-27-36-38(34(2,3)4,30-19-10-6-11-20-30)31-21-12-7-13-22-31/h5-13,15-22,25,32-33H,14,23-24,26-27H2,1-4H3/t32-,33+,35-/m1/s1 |
| InChIKey | WGGHPOFKLSQRRB-RDUMUFLSSA-N |
| XLogP | 8.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|