C37H54OSSi — CID 57286001
tert-butyl-dimethyl-[(2R,4R)-4-methyl-1-tritylsulfanylundecan-2-yl]oxysilane (PubChem CID 57286001) has the molecular formula C37H54OSSi and a molecular weight of 574.99 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,4R)-4-methyl-1-tritylsulfanylundecan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,4R)-4-methyl-1-tritylsulfanylundecan-2-yl]oxysilane |
|---|---|
| PubChem CID | 57286001 |
| Molecular Formula | C37H54OSSi |
| Molecular Weight | 574.99 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,4R)-4-methyl-1-tritylsulfanylundecan-2-yl]oxysilane |
| SMILES | CCCCCCC[C@@H](C)C[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H54OSSi/c1-8-9-10-11-15-22-31(2)29-35(38-40(6,7)36(3,4)5)30-39-37(32-23-16-12-17-24-32,33-25-18-13-19-26-33)34-27-20-14-21-28-34/h12-14,16-21,23-28,31,35H,8-11,15,22,29-30H2,1-7H3/t31-,35-/m1/s1 |
| InChIKey | BBJRUDYIOMSJIR-CYEXUTLASA-N |
| XLogP | 11.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.99 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|