C28H36OSSi — CID 134929314
[(1R,2R)-2-benzylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-tert-butyl-dimethylsilane (PubChem CID 134929314) has the molecular formula C28H36OSSi and a molecular weight of 448.75 g/mol. Its IUPAC name is [(1R,2R)-2-benzylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R)-2-benzylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134929314 |
| Molecular Formula | C28H36OSSi |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | [(1R,2R)-2-benzylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-tert-butyl-dimethylsilane |
| SMILES | Cc1ccc([C@@H](SCc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H36OSSi/c1-22-17-19-25(20-18-22)27(30-21-23-13-9-7-10-14-23)26(24-15-11-8-12-16-24)29-31(5,6)28(2,3)4/h7-20,26-27H,21H2,1-6H3/t26-,27-/m1/s1 |
| InChIKey | MYXNYLRRODUYSZ-KAYWLYCHSA-N |
| XLogP | 8.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|