C14H22OS2Si — CID 11022916
[1,3-dithian-2-yl(phenyl)methoxy]-trimethylsilane (PubChem CID 11022916) has the molecular formula C14H22OS2Si and a molecular weight of 298.55 g/mol. Its IUPAC name is [1,3-dithian-2-yl(phenyl)methoxy]-trimethylsilane.
| Compound Name | [1,3-dithian-2-yl(phenyl)methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11022916 |
| Molecular Formula | C14H22OS2Si |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | [1,3-dithian-2-yl(phenyl)methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)C1SCCCS1 |
| InChI | InChI=1S/C14H22OS2Si/c1-18(2,3)15-13(12-8-5-4-6-9-12)14-16-10-7-11-17-14/h4-6,8-9,13-14H,7,10-11H2,1-3H3 |
| InChIKey | IPYDAVWYQMASAS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|