C26H40OSi2 — CID 11201083
tert-butyl-[(E)-5-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)pent-3-enoxy]-dimethylsilane (PubChem CID 11201083) has the molecular formula C26H40OSi2 and a molecular weight of 424.78 g/mol. Its IUPAC name is tert-butyl-[(E)-5-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)pent-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-5-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)pent-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11201083 |
| Molecular Formula | C26H40OSi2 |
| Molecular Weight | 424.78 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | tert-butyl-[(E)-5-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)pent-3-enoxy]-dimethylsilane |
| SMILES | Cc1ccc(C(C/C=C/C[Si](C)(C)c2ccccc2)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H40OSi2/c1-22-17-19-23(20-18-22)25(27-29(7,8)26(2,3)4)16-12-13-21-28(5,6)24-14-10-9-11-15-24/h9-15,17-20,25H,16,21H2,1-8H3/b13-12+ |
| InChIKey | LLBVOZGLVROWJR-OUKQBFOZSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.78 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|