C28H34OS2Si — CID 10719457
2,2-bis(phenylsulfanyl)ethyl-dimethyl-(1-phenylhex-5-en-3-yloxy)silane (PubChem CID 10719457) has the molecular formula C28H34OS2Si and a molecular weight of 478.80 g/mol. Its IUPAC name is 2,2-bis(phenylsulfanyl)ethyl-dimethyl-(1-phenylhex-5-en-3-yloxy)silane.
| Compound Name | 2,2-bis(phenylsulfanyl)ethyl-dimethyl-(1-phenylhex-5-en-3-yloxy)silane |
|---|---|
| PubChem CID | 10719457 |
| Molecular Formula | C28H34OS2Si |
| Molecular Weight | 478.80 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2,2-bis(phenylsulfanyl)ethyl-dimethyl-(1-phenylhex-5-en-3-yloxy)silane |
| SMILES | C=CCC(CCc1ccccc1)O[Si](C)(C)CC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C28H34OS2Si/c1-4-14-25(22-21-24-15-8-5-9-16-24)29-32(2,3)23-28(30-26-17-10-6-11-18-26)31-27-19-12-7-13-20-27/h4-13,15-20,25,28H,1,14,21-23H2,2-3H3 |
| InChIKey | NXSLEZPJSHAICD-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.80 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|