C28H44OS2Si — CID 134877975
1,1-bis(phenylsulfanyl)undecan-3-yloxy-dimethyl-propylsilane (PubChem CID 134877975) has the molecular formula C28H44OS2Si and a molecular weight of 488.88 g/mol. Its IUPAC name is 1,1-bis(phenylsulfanyl)undecan-3-yloxy-dimethyl-propylsilane.
| Compound Name | 1,1-bis(phenylsulfanyl)undecan-3-yloxy-dimethyl-propylsilane |
|---|---|
| PubChem CID | 134877975 |
| Molecular Formula | C28H44OS2Si |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 1,1-bis(phenylsulfanyl)undecan-3-yloxy-dimethyl-propylsilane |
| SMILES | CCCCCCCCC(CC(Sc1ccccc1)Sc1ccccc1)O[Si](C)(C)CCC |
| InChI | InChI=1S/C28H44OS2Si/c1-5-7-8-9-10-13-18-25(29-32(3,4)23-6-2)24-28(30-26-19-14-11-15-20-26)31-27-21-16-12-17-22-27/h11-12,14-17,19-22,25,28H,5-10,13,18,23-24H2,1-4H3 |
| InChIKey | FQKLAFHGTINJJI-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|